C22H35N8O9P — CID 53476340
ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate (PubChem CID 53476340) has the molecular formula C22H35N8O9P and a molecular weight of 586.54 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 53476340 |
| Molecular Formula | C22H35N8O9P |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-ethoxy-2-oxoethyl)amino]phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(NCC(=O)OCC)OC[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C22H35N8O9P/c1-4-36-14(31)8-25-40(35,26-9-15(32)37-5-2)38-10-13-17(33)22(3,34)20(39-13)30-11-24-16-18(27-12-6-7-12)28-21(23)29-19(16)30/h11-13,17,20,33-34H,4-10H2,1-3H3,(H2,25,26,35)(H3,23,27,28,29)/t13-,17-,20-,22-/m1/s1 |
| InChIKey | KFFMQPHLIPZVRU-LWEHPVCGSA-N |
| XLogP | -0.58 |
| TPSA | 234.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|