C33H41N6O11P — CID 71478763
ethyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-ethoxy-3-oxopropyl)phenoxy]phosphoryl]oxyphenyl]propanoate (PubChem CID 71478763) has the molecular formula C33H41N6O11P and a molecular weight of 728.70 g/mol. Its IUPAC name is ethyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-ethoxy-3-oxopropyl)phenoxy]phosphoryl]oxyphenyl]propanoate.
| Compound Name | ethyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-ethoxy-3-oxopropyl)phenoxy]phosphoryl]oxyphenyl]propanoate |
|---|---|
| PubChem CID | 71478763 |
| Molecular Formula | C33H41N6O11P |
| Molecular Weight | 728.70 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | ethyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-ethoxy-3-oxopropyl)phenoxy]phosphoryl]oxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccccc1OP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@@](C)(O)[C@H]1O)Oc1ccccc1CCC(=O)OCC |
| InChI | InChI=1S/C33H41N6O11P/c1-4-45-25(40)16-14-20-10-6-8-12-22(20)49-51(44,50-23-13-9-7-11-21(23)15-17-26(41)46-5-2)47-18-24-28(42)33(3,43)31(48-24)39-19-36-27-29(34)37-32(35)38-30(27)39/h6-13,19,24,28,31,42-43H,4-5,14-18H2,1-3H3,(H4,34,35,37,38)/t24-,28+,31-,33+/m1/s1 |
| InChIKey | OIRMGHBLFXLFMC-YUQOACCUSA-N |
| XLogP | 3.27 |
| TPSA | 242.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.70 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|