C33H40FN6O10P — CID 71478569
methyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxo-3-propan-2-yloxypropyl)phenoxy]phosphoryl]oxyphenyl]propanoate (PubChem CID 71478569) has the molecular formula C33H40FN6O10P and a molecular weight of 730.69 g/mol. Its IUPAC name is methyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxo-3-propan-2-yloxypropyl)phenoxy]phosphoryl]oxyphenyl]propanoate.
| Compound Name | methyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxo-3-propan-2-yloxypropyl)phenoxy]phosphoryl]oxyphenyl]propanoate |
|---|---|
| PubChem CID | 71478569 |
| Molecular Formula | C33H40FN6O10P |
| Molecular Weight | 730.69 g/mol |
| Exact Mass | 730.25 |
| IUPAC Name | methyl 3-[2-[[(2R,3S,4S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-[2-(3-oxo-3-propan-2-yloxypropyl)phenoxy]phosphoryl]oxyphenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1OP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@@](C)(F)[C@H]1O)Oc1ccccc1CCC(=O)OC(C)C |
| InChI | InChI=1S/C33H40FN6O10P/c1-19(2)47-26(42)16-14-21-10-6-8-12-23(21)50-51(44,49-22-11-7-5-9-20(22)13-15-25(41)45-4)46-17-24-28(43)33(3,34)31(48-24)40-18-37-27-29(35)38-32(36)39-30(27)40/h5-12,18-19,24,28,31,43H,13-17H2,1-4H3,(H4,35,36,38,39)/t24-,28+,31-,33+,51?/m1/s1 |
| InChIKey | PARHYMSXUBTVQX-HQVRMZGWSA-N |
| XLogP | 4.25 |
| TPSA | 222.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|