C26H32BrFN5O8P — CID 159986663
(3S)-4-[[(2R,4S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one (PubChem CID 159986663) has the molecular formula C26H32BrFN5O8P and a molecular weight of 672.45 g/mol. Its IUPAC name is (3S)-4-[[(2R,4S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-[[(2R,4S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 159986663 |
| Molecular Formula | C26H32BrFN5O8P |
| Molecular Weight | 672.45 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | (3S)-4-[[(2R,4S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-bromo-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(3-oxobutyl)phenoxy]phosphoryl]-3-methylbutan-2-one |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(C[C@@H](C)C(C)=O)Oc2ccccc2CCC(C)=O)C(O)[C@]1(F)Br |
| InChI | InChI=1S/C26H32BrFN5O8P/c1-14(16(3)35)12-42(37,41-18-8-6-5-7-17(18)10-9-15(2)34)39-11-19-21(36)26(27,28)24(40-19)33-13-30-20-22(33)31-25(29)32-23(20)38-4/h5-8,13-14,19,21,24,36H,9-12H2,1-4H3,(H2,29,31,32)/t14-,19-,21?,24-,26-,42?/m1/s1 |
| InChIKey | ZKMSYKHWZWVNEL-PTSCOMMQSA-N |
| XLogP | 3.77 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|