C22H26Cl2N5O7P — CID 158015604
(3S)-4-[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-3-methylbutan-2-one (PubChem CID 158015604) has the molecular formula C22H26Cl2N5O7P and a molecular weight of 574.36 g/mol. Its IUPAC name is (3S)-4-[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 158015604 |
| Molecular Formula | C22H26Cl2N5O7P |
| Molecular Weight | 574.36 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | (3S)-4-[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-3-methylbutan-2-one |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(C[C@@H](C)C(C)=O)Oc2ccccc2)[C@H](O)C1(Cl)Cl |
| InChI | InChI=1S/C22H26Cl2N5O7P/c1-12(13(2)30)10-37(32,36-14-7-5-4-6-8-14)34-9-15-17(31)22(23,24)20(35-15)29-11-26-16-18(29)27-21(25)28-19(16)33-3/h4-8,11-12,15,17,20,31H,9-10H2,1-3H3,(H2,25,27,28)/t12-,15-,17+,20-,37?/m1/s1 |
| InChIKey | PFYMTLFJKDFNOK-RUAZABGJSA-N |
| XLogP | 3.36 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|