C25H34N7O8P — CID 149342185
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyl-4-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 149342185) has the molecular formula C25H34N7O8P and a molecular weight of 591.56 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyl-4-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyl-4-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 149342185 |
| Molecular Formula | C25H34N7O8P |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyl-4-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=N[C@]1(C)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1cnc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C25H34N7O8P/c1-14(2)38-22(34)15(3)31-41(35,40-16-10-8-7-9-11-16)37-12-17-19(33)25(4,27-5)23(39-17)32-13-28-18-20(32)29-24(26)30-21(18)36-6/h7-11,13-15,17,19,23,33H,5,12H2,1-4,6H3,(H,31,35)(H2,26,29,30)/t15-,17+,19+,23+,25+,41?/m0/s1 |
| InChIKey | YEJYZHRTOWYWSV-ONAIKPJWSA-N |
| XLogP | 2.27 |
| TPSA | 194.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|