C24H32N9O8P — CID 70914761
propyl (2S)-2-[[[(2R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 70914761) has the molecular formula C24H32N9O8P and a molecular weight of 605.55 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl (2S)-2-[[[(2R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70914761 |
| Molecular Formula | C24H32N9O8P |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | propyl (2S)-2-[[[(2R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(N=[N+]=[N-])C1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H32N9O8P/c1-5-11-38-21(35)14(2)30-42(36,41-15-9-7-6-8-10-15)39-12-16-18(34)24(3,31-32-26)22(40-16)33-13-27-17-19(33)28-23(25)29-20(17)37-4/h6-10,13-14,16,18,22,34H,5,11-12H2,1-4H3,(H,30,36)(H2,25,28,29)/t14-,16+,18?,22+,24+,42?/m0/s1 |
| InChIKey | POQHGZNAVMSZNF-ZSXFSOFKSA-N |
| XLogP | 2.88 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|