C23H30N9O7P — CID 70914644
(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[(oxan-4-ylamino)-phenoxyphosphoryl]oxymethyl]oxolan-3-ol (PubChem CID 70914644) has the molecular formula C23H30N9O7P and a molecular weight of 575.52 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[(oxan-4-ylamino)-phenoxyphosphoryl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[(oxan-4-ylamino)-phenoxyphosphoryl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 70914644 |
| Molecular Formula | C23H30N9O7P |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | (2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[(oxan-4-ylamino)-phenoxyphosphoryl]oxymethyl]oxolan-3-ol |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(NC2CCOCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C23H30N9O7P/c1-23(30-31-25)18(33)16(38-21(23)32-13-26-17-19(32)27-22(24)28-20(17)35-2)12-37-40(34,29-14-8-10-36-11-9-14)39-15-6-4-3-5-7-15/h3-7,13-14,16,18,21,33H,8-12H2,1-2H3,(H,29,34)(H2,24,27,28)/t16-,18-,21-,23-,40?/m1/s1 |
| InChIKey | JTNBTUYTBDCYBC-LYOMDOTJSA-N |
| XLogP | 2.72 |
| TPSA | 213.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|