C27H36N9O8P — CID 90299984
ethyl 2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclobutylamino)phosphoryl]oxy-2-phenylacetate (PubChem CID 90299984) has the molecular formula C27H36N9O8P and a molecular weight of 645.61 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclobutylamino)phosphoryl]oxy-2-phenylacetate.
| Compound Name | ethyl 2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclobutylamino)phosphoryl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 90299984 |
| Molecular Formula | C27H36N9O8P |
| Molecular Weight | 645.61 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | ethyl 2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclobutylamino)phosphoryl]oxy-2-phenylacetate |
| SMILES | CCOC(=O)C(OP(=O)(NC1CCC1)OC[C@H]1O[C@@H](n2cnc3c(OCC)nc(N)nc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H36N9O8P/c1-4-40-23-19-22(31-26(28)32-23)36(15-30-19)25-27(3,34-35-29)21(37)18(43-25)14-42-45(39,33-17-12-9-13-17)44-20(24(38)41-5-2)16-10-7-6-8-11-16/h6-8,10-11,15,17-18,20-21,25,37H,4-5,9,12-14H2,1-3H3,(H,33,39)(H2,28,31,32)/t18-,20?,21-,25-,27-,45?/m1/s1 |
| InChIKey | YMXYSMQZLPVVDN-RVSBPLOXSA-N |
| XLogP | 3.72 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|