C21H27N8O6P — CID 90299985
(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[methyl-[(1S)-1-phenylethoxy]phosphoryl]oxymethyl]oxolan-3-ol (PubChem CID 90299985) has the molecular formula C21H27N8O6P and a molecular weight of 518.47 g/mol. Its IUPAC name is (2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[methyl-[(1S)-1-phenylethoxy]phosphoryl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[methyl-[(1S)-1-phenylethoxy]phosphoryl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 90299985 |
| Molecular Formula | C21H27N8O6P |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-4-methyl-2-[[methyl-[(1S)-1-phenylethoxy]phosphoryl]oxymethyl]oxolan-3-ol |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(C)(=O)O[C@@H](C)c2ccccc2)[C@@H](O)C1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C21H27N8O6P/c1-12(13-8-6-5-7-9-13)35-36(4,31)33-10-14-16(30)21(2,27-28-23)19(34-14)29-11-24-15-17(29)25-20(22)26-18(15)32-3/h5-9,11-12,14,16,19,30H,10H2,1-4H3,(H2,22,25,26)/t12-,14+,16+,19+,21?,36?/m0/s1 |
| InChIKey | YDBBKNDIYCKIHX-MKWRJVBGSA-N |
| XLogP | 3.36 |
| TPSA | 192.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|