C17H26N9O5P — CID 70914766
(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-2-[[(cyclopropylamino)-methylphosphoryl]oxymethyl]-4-methyloxolan-3-ol (PubChem CID 70914766) has the molecular formula C17H26N9O5P and a molecular weight of 467.43 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-2-[[(cyclopropylamino)-methylphosphoryl]oxymethyl]-4-methyloxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-2-[[(cyclopropylamino)-methylphosphoryl]oxymethyl]-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 70914766 |
| Molecular Formula | C17H26N9O5P |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-2-[[(cyclopropylamino)-methylphosphoryl]oxymethyl]-4-methyloxolan-3-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(C)(=O)NC2CC2)[C@@H](O)[C@@]1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C17H26N9O5P/c1-4-29-14-11-13(21-16(18)22-14)26(8-20-11)15-17(2,24-25-19)12(27)10(31-15)7-30-32(3,28)23-9-5-6-9/h8-10,12,15,27H,4-7H2,1-3H3,(H,23,28)(H2,18,21,22)/t10-,12-,15-,17-,32?/m1/s1 |
| InChIKey | JGBHGQZFFFEWET-LISXSQSISA-N |
| XLogP | 1.73 |
| TPSA | 195.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|