C13H19FN5O7P — CID 53466215
[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 53466215) has the molecular formula C13H19FN5O7P and a molecular weight of 407.30 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 53466215 |
| Molecular Formula | C13H19FN5O7P |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C13H19FN5O7P/c1-3-24-10-7-9(17-12(15)18-10)19(5-16-7)11-13(2,14)8(20)6(26-11)4-25-27(21,22)23/h5-6,8,11,20H,3-4H2,1-2H3,(H2,15,17,18)(H2,21,22,23)/t6-,8-,11-,13-/m1/s1 |
| InChIKey | MDKSEPIXNNFOQG-VHQAPHLWSA-N |
| XLogP | -0.10 |
| TPSA | 175.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|