C19H22FN5O5 — CID 118054036
(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-4-methyl-2-(phenylperoxymethyl)oxolan-3-ol (PubChem CID 118054036) has the molecular formula C19H22FN5O5 and a molecular weight of 419.41 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-4-methyl-2-(phenylperoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-4-methyl-2-(phenylperoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118054036 |
| Molecular Formula | C19H22FN5O5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-4-methyl-2-(phenylperoxymethyl)oxolan-3-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COOc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C19H22FN5O5/c1-3-27-16-13-15(23-18(21)24-16)25(10-22-13)17-19(2,20)14(26)12(29-17)9-28-30-11-7-5-4-6-8-11/h4-8,10,12,14,17,26H,3,9H2,1-2H3,(H2,21,23,24)/t12-,14-,17-,19-/m1/s1 |
| InChIKey | HXNQREPLSXPADO-KJMSJTNLSA-N |
| XLogP | 1.80 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|