C17H29FN6O3Si — CID 71014039
(2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-3-ol (PubChem CID 71014039) has the molecular formula C17H29FN6O3Si and a molecular weight of 412.54 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 71014039 |
| Molecular Formula | C17H29FN6O3Si |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C17H29FN6O3Si/c1-16(2,3)28(5,6)26-7-9-11(25)17(4,18)14(27-9)24-8-21-10-12(19)22-15(20)23-13(10)24/h8-9,11,14,25H,7H2,1-6H3,(H4,19,20,22,23)/t9-,11-,14-,17-/m1/s1 |
| InChIKey | HGTRAKOMMROARR-XDSJBIEASA-N |
| XLogP | 2.00 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|