C11H14F2N6O3 — CID 134249551
(2S,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 134249551) has the molecular formula C11H14F2N6O3 and a molecular weight of 316.27 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2S,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 134249551 |
| Molecular Formula | C11H14F2N6O3 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S,3S,4R,5R)-5-(2,6-diaminopurin-9-yl)-2,4-difluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@]1(F)[C@H](n2cnc3c(N)nc(N)nc32)O[C@](F)(CO)[C@H]1O |
| InChI | InChI=1S/C11H14F2N6O3/c1-10(12)7(21)11(13,2-20)22-8(10)19-3-16-4-5(14)17-9(15)18-6(4)19/h3,7-8,20-21H,2H2,1H3,(H4,14,15,17,18)/t7-,8+,10+,11+/m0/s1 |
| InChIKey | UEWYPPNDMIPTIN-SCVMZPAESA-N |
| XLogP | -0.73 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |