C11H15FN6O2 — CID 66696300
[(2S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-2-yl]methanol (PubChem CID 66696300) has the molecular formula C11H15FN6O2 and a molecular weight of 282.28 g/mol. Its IUPAC name is [(2S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 66696300 |
| Molecular Formula | C11H15FN6O2 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [(2S,5R)-5-(2,6-diaminopurin-9-yl)-4-fluoro-4-methyloxolan-2-yl]methanol |
| SMILES | CC1(F)C[C@@H](CO)O[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C11H15FN6O2/c1-11(12)2-5(3-19)20-9(11)18-4-15-6-7(13)16-10(14)17-8(6)18/h4-5,9,19H,2-3H2,1H3,(H4,13,14,16,17)/t5-,9+,11?/m0/s1 |
| InChIKey | DIXSTGWZPRDSPK-JJJLSQATSA-N |
| XLogP | -0.00 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |