C10H13FN6O2 — CID 57008167
[(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluorooxolan-2-yl]methanol (PubChem CID 57008167) has the molecular formula C10H13FN6O2 and a molecular weight of 268.25 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 57008167 |
| Molecular Formula | C10H13FN6O2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(2S,4R,5R)-5-(2,6-diaminopurin-9-yl)-4-fluorooxolan-2-yl]methanol |
| SMILES | Nc1nc(N)c2ncn([C@@H]3O[C@H](CO)C[C@H]3F)c2n1 |
| InChI | InChI=1S/C10H13FN6O2/c11-5-1-4(2-18)19-9(5)17-3-14-6-7(12)15-10(13)16-8(6)17/h3-5,9,18H,1-2H2,(H4,12,13,15,16)/t4-,5+,9+/m0/s1 |
| InChIKey | PHDRWZXWRBXBOC-OBXARNEKSA-N |
| XLogP | -0.39 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |