C11H13ClFN5O2 — CID 157481139
6-chloro-9-[(2R,3S,5S)-3-fluoro-5-(methoxymethyl)oxolan-2-yl]purin-2-amine (PubChem CID 157481139) has the molecular formula C11H13ClFN5O2 and a molecular weight of 301.71 g/mol. Its IUPAC name is 6-chloro-9-[(2R,3S,5S)-3-fluoro-5-(methoxymethyl)oxolan-2-yl]purin-2-amine.
| Compound Name | 6-chloro-9-[(2R,3S,5S)-3-fluoro-5-(methoxymethyl)oxolan-2-yl]purin-2-amine |
|---|---|
| PubChem CID | 157481139 |
| Molecular Formula | C11H13ClFN5O2 |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 6-chloro-9-[(2R,3S,5S)-3-fluoro-5-(methoxymethyl)oxolan-2-yl]purin-2-amine |
| SMILES | COC[C@@H]1C[C@H](F)[C@H](n2cnc3c(Cl)nc(N)nc32)O1 |
| InChI | InChI=1S/C11H13ClFN5O2/c1-19-3-5-2-6(13)10(20-5)18-4-15-7-8(12)16-11(14)17-9(7)18/h4-6,10H,2-3H2,1H3,(H2,14,16,17)/t5-,6-,10+/m0/s1 |
| InChIKey | BWEBPGQZMCPYAK-JFWOZONXSA-N |
| XLogP | 1.33 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |