C18H18ClN5O3 — CID 173469042
[(2R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 173469042) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is [(2R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 173469042 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(2R,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | CC1C[C@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C18H18ClN5O3/c1-10-7-12(8-26-17(25)11-5-3-2-4-6-11)27-16(10)24-9-21-13-14(19)22-18(20)23-15(13)24/h2-6,9-10,12,16H,7-8H2,1H3,(H2,20,22,23)/t10?,12-,16-/m1/s1 |
| InChIKey | HKNPAAHITCSOGH-WPJLSRQMSA-N |
| XLogP | 2.84 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |