C23H30ClN6O6P — CID 144606398
propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 144606398) has the molecular formula C23H30ClN6O6P and a molecular weight of 552.96 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144606398 |
| Molecular Formula | C23H30ClN6O6P |
| Molecular Weight | 552.96 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-chloropurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OC[C@@H]1C[C@H](C)[C@H](n2cnc3c(Cl)nc(N)nc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C23H30ClN6O6P/c1-13(2)34-22(31)15(4)29-37(32,36-16-8-6-5-7-9-16)33-11-17-10-14(3)21(35-17)30-12-26-18-19(24)27-23(25)28-20(18)30/h5-9,12-15,17,21H,10-11H2,1-4H3,(H,29,32)(H2,25,27,28)/t14-,15?,17-,21+,37?/m0/s1 |
| InChIKey | WSLRKXBVRLVRFD-NIKIEXNUSA-N |
| XLogP | 4.12 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|