C21H27N6O7P — CID 123685936
2-[[[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetic acid (PubChem CID 123685936) has the molecular formula C21H27N6O7P and a molecular weight of 506.46 g/mol. Its IUPAC name is 2-[[[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetic acid.
| Compound Name | 2-[[[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetic acid |
|---|---|
| PubChem CID | 123685936 |
| Molecular Formula | C21H27N6O7P |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[[[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetic acid |
| SMILES | CCOc1nc(N)nc2c1ncn2C1OC(COP(=O)(NCC(=O)O)Oc2ccccc2)CC1C |
| InChI | InChI=1S/C21H27N6O7P/c1-3-31-19-17-18(25-21(22)26-19)27(12-23-17)20-13(2)9-15(33-20)11-32-35(30,24-10-16(28)29)34-14-7-5-4-6-8-14/h4-8,12-13,15,20H,3,9-11H2,1-2H3,(H,24,30)(H,28,29)(H2,22,25,26) |
| InChIKey | VAEBXVUMDVLIFV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|