C28H33N6O8P — CID 137401602
benzyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-(2-hydroxyethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 137401602) has the molecular formula C28H33N6O8P and a molecular weight of 612.58 g/mol. Its IUPAC name is benzyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-(2-hydroxyethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-(2-hydroxyethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 137401602 |
| Molecular Formula | C28H33N6O8P |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | benzyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-(2-hydroxyethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | COc1nc(N)nc2c1ncn2C1OC(COP(=O)(NCC(=O)OCc2ccccc2)Oc2ccccc2)CC1CCO |
| InChI | InChI=1S/C28H33N6O8P/c1-38-26-24-25(32-28(29)33-26)34(18-30-24)27-20(12-13-35)14-22(41-27)17-40-43(37,42-21-10-6-3-7-11-21)31-15-23(36)39-16-19-8-4-2-5-9-19/h2-11,18,20,22,27,35H,12-17H2,1H3,(H,31,37)(H2,29,32,33) |
| InChIKey | UNGKXAMCABIEMR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|