C25H35N6O7P — CID 144606348
propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 144606348) has the molecular formula C25H35N6O7P and a molecular weight of 562.56 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144606348 |
| Molecular Formula | C25H35N6O7P |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C25H35N6O7P/c1-6-34-22-20-21(28-25(26)29-22)31(14-27-20)23-16(4)12-19(37-23)13-35-39(33,38-18-10-8-7-9-11-18)30-17(5)24(32)36-15(2)3/h7-11,14-17,19,23H,6,12-13H2,1-5H3,(H,30,33)(H2,26,28,29)/t16-,17?,19-,23+,39?/m0/s1 |
| InChIKey | ICSTUTGQLLTALF-OCVUPJNSSA-N |
| XLogP | 3.86 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|