C25H26ClN6O7P — CID 145410598
benzyl 2-[[[(5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]acetate (PubChem CID 145410598) has the molecular formula C25H26ClN6O7P and a molecular weight of 588.95 g/mol. Its IUPAC name is benzyl 2-[[[(5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[[(5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 145410598 |
| Molecular Formula | C25H26ClN6O7P |
| Molecular Weight | 588.95 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | benzyl 2-[[[(5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]acetate |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@H]1CC(OP(=O)(NCC(=O)OCc2ccccc2)Oc2ccccc2)C(CO)O1 |
| InChI | InChI=1S/C25H26ClN6O7P/c26-25-30-23(27)22-24(31-25)32(15-28-22)20-11-18(19(13-33)37-20)39-40(35,38-17-9-5-2-6-10-17)29-12-21(34)36-14-16-7-3-1-4-8-16/h1-10,15,18-20,33H,11-14H2,(H,29,35)(H2,27,30,31)/t18?,19?,20-,40?/m1/s1 |
| InChIKey | XAZTWIOBBMPYBW-VVZRJHASSA-N |
| XLogP | 3.25 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|