C38H51ClN7O6P — CID 123301000
N-[2-[[[5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 123301000) has the molecular formula C38H51ClN7O6P and a molecular weight of 768.30 g/mol. Its IUPAC name is N-[2-[[[5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | N-[2-[[[5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 123301000 |
| Molecular Formula | C38H51ClN7O6P |
| Molecular Weight | 768.30 g/mol |
| Exact Mass | 767.33 |
| IUPAC Name | N-[2-[[[5-(6-amino-2-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNP(=O)(OCC1OC(n2cnc3c(N)nc(Cl)nc32)CC1O)Oc1ccccc1 |
| InChI | InChI=1S/C38H51ClN7O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-33(48)41-25-26-43-53(49,52-30-22-19-18-20-23-30)50-28-32-31(47)27-34(51-32)46-29-42-35-36(40)44-38(39)45-37(35)46/h3-4,6-7,9-10,12-13,15-16,18-20,22-23,29,31-32,34,47H,2,5,8,11,14,17,21,24-28H2,1H3,(H,41,48)(H,43,49)(H2,40,44,45) |
| InChIKey | HAIJGXGVGSTZLJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 175.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.30 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|