C19H21ClN5O9P — CID 156529350
[1-[[(2R,3S,4R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-2-phenylmethoxyethyl]phosphonic acid (PubChem CID 156529350) has the molecular formula C19H21ClN5O9P and a molecular weight of 529.83 g/mol. Its IUPAC name is [1-[[(2R,3S,4R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-2-phenylmethoxyethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-2-phenylmethoxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 156529350 |
| Molecular Formula | C19H21ClN5O9P |
| Molecular Weight | 529.83 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [1-[[(2R,3S,4R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxo-2-phenylmethoxyethyl]phosphonic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1O[C@H](COC(C(=O)OCc2ccccc2)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21ClN5O9P/c20-19-23-14(21)11-15(24-19)25(8-22-11)16-13(27)12(26)10(34-16)7-33-18(35(29,30)31)17(28)32-6-9-4-2-1-3-5-9/h1-5,8,10,12-13,16,18,26-27H,6-7H2,(H2,21,23,24)(H2,29,30,31)/t10-,12-,13-,16?,18?/m1/s1 |
| InChIKey | LHZBFAKFRKQRCT-QEIJTKSASA-N |
| XLogP | -0.06 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.83 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|