C21H26N5O9P — CID 118469412
[(1S)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-benzylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469412) has the molecular formula C21H26N5O9P and a molecular weight of 523.44 g/mol. Its IUPAC name is [(1S)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-benzylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1S)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-benzylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469412 |
| Molecular Formula | C21H26N5O9P |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [(1S)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-benzylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@@H](OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cc4ccccc4)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C21H26N5O9P/c1-2-33-20(29)21(36(30,31)32)34-9-12-15(27)16(28)19(35-12)26-10-23-14-17(22)24-13(25-18(14)26)8-11-6-4-3-5-7-11/h3-7,10,12,15-16,19,21,27-28H,2,8-9H2,1H3,(H2,22,24,25)(H2,30,31,32)/t12-,15-,16-,19-,21+/m1/s1 |
| InChIKey | DVRWGMXKWGOBLR-IMIWPISTSA-N |
| XLogP | -0.30 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|