C16H24N5O9PS — CID 118469749
[(1R)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469749) has the molecular formula C16H24N5O9PS and a molecular weight of 493.44 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469749 |
| Molecular Formula | C16H24N5O9PS |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [(1R)-1-[[(2R,3S,4R,5R)-5-(6-amino-2-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(N)nc(SCC)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C16H24N5O9PS/c1-3-28-14(24)15(31(25,26)27)29-5-7-9(22)10(23)13(30-7)21-6-18-8-11(17)19-16(32-4-2)20-12(8)21/h6-7,9-10,13,15,22-23H,3-5H2,1-2H3,(H2,17,19,20)(H2,25,26,27)/t7-,9-,10-,13-,15-/m1/s1 |
| InChIKey | HQJJPBJNACPITL-WKLITFCYSA-N |
| XLogP | -0.78 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|