C13H17FN5O8P — CID 135194289
(2R)-2-[[(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 135194289) has the molecular formula C13H17FN5O8P and a molecular weight of 421.28 g/mol. Its IUPAC name is (2R)-2-[[(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | (2R)-2-[[(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 135194289 |
| Molecular Formula | C13H17FN5O8P |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2R)-2-[[(2R,3R,4S,5R)-5-(6-amino-2-methylpurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](CO[C@@H](C(=O)O)P(=O)(O)O)[C@@H](O)[C@@H]3F)c2n1 |
| InChI | InChI=1S/C13H17FN5O8P/c1-4-17-9(15)7-10(18-4)19(3-16-7)11-6(14)8(20)5(27-11)2-26-13(12(21)22)28(23,24)25/h3,5-6,8,11,13,20H,2H2,1H3,(H,21,22)(H2,15,17,18)(H2,23,24,25)/t5-,6+,8-,11-,13-/m1/s1 |
| InChIKey | LARALNNFOFTTFG-IKCUYNJBSA-N |
| XLogP | -1.08 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|