C12H16N5O9P — CID 75587303
2-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 75587303) has the molecular formula C12H16N5O9P and a molecular weight of 405.26 g/mol. Its IUPAC name is 2-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | 2-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 75587303 |
| Molecular Formula | C12H16N5O9P |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | Nc1ncnc2c1ncn2C1OC(COC(C(=O)O)P(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C12H16N5O9P/c13-8-5-9(15-2-14-8)17(3-16-5)10-7(19)6(18)4(26-10)1-25-12(11(20)21)27(22,23)24/h2-4,6-7,10,12,18-19H,1H2,(H,20,21)(H2,13,14,15)(H2,22,23,24) |
| InChIKey | FMUBZCDCFYIVTM-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 223.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|