C18H20N5O9P — CID 118469753
2-[[(2R,3S,4R,5R)-5-(6-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 118469753) has the molecular formula C18H20N5O9P and a molecular weight of 481.36 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 118469753 |
| Molecular Formula | C18H20N5O9P |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | O=C(O)C(OC[C@H]1O[C@@H](n2cnc3c(Nc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C18H20N5O9P/c24-12-10(6-31-18(17(26)27)33(28,29)30)32-16(13(12)25)23-8-21-11-14(19-7-20-15(11)23)22-9-4-2-1-3-5-9/h1-5,7-8,10,12-13,16,18,24-25H,6H2,(H,26,27)(H,19,20,22)(H2,28,29,30)/t10-,12-,13-,16-,18?/m1/s1 |
| InChIKey | BMLJLDZEZRMGAF-CMAHQRSQSA-N |
| XLogP | -0.21 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|