C20H25N7O12P2 — CID 59812599
2-amino-3-[[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]propanoic acid (PubChem CID 59812599) has the molecular formula C20H25N7O12P2 and a molecular weight of 617.41 g/mol. Its IUPAC name is 2-amino-3-[[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]propanoic acid.
| Compound Name | 2-amino-3-[[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]propanoic acid |
|---|---|
| PubChem CID | 59812599 |
| Molecular Formula | C20H25N7O12P2 |
| Molecular Weight | 617.41 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 2-amino-3-[[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]propanoic acid |
| SMILES | NC(CP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)[C@@H](O)C1O)C(=O)O |
| InChI | InChI=1S/C20H25N7O12P2/c21-11(19(30)31)7-40(33,34)39-41(35,36)37-6-12-14(28)15(29)18(38-12)27-9-24-13-16(22-8-23-17(13)27)26-20(32)25-10-4-2-1-3-5-10/h1-5,8-9,11-12,14-15,18,28-29H,6-7,21H2,(H,30,31)(H,33,34)(H,35,36)(H2,22,23,25,26,32)/t11?,12-,14?,15+,18-/m1/s1 |
| InChIKey | OKJAQAUPFNTOIC-YUSCFGQNSA-N |
| XLogP | -0.18 |
| TPSA | 290.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|