C24H25N6O7P — CID 59812693
benzyl-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphinic acid (PubChem CID 59812693) has the molecular formula C24H25N6O7P and a molecular weight of 540.47 g/mol. Its IUPAC name is benzyl-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | benzyl-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 59812693 |
| Molecular Formula | C24H25N6O7P |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | benzyl-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphinic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)Cc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C24H25N6O7P/c31-19-17(11-36-38(34,35)12-15-7-3-1-4-8-15)37-23(20(19)32)30-14-27-18-21(25-13-26-22(18)30)29-24(33)28-16-9-5-2-6-10-16/h1-10,13-14,17,19-20,23,31-32H,11-12H2,(H,34,35)(H2,25,26,28,29,33)/t17-,19?,20+,23-/m1/s1 |
| InChIKey | QUHJYHDMAGRXLH-NWYAXVINSA-N |
| XLogP | 2.49 |
| TPSA | 180.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|