C19H23N6O8P — CID 71372463
[(2R,3S,4R,5R)-5-[6-[(4-acetamidophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71372463) has the molecular formula C19H23N6O8P and a molecular weight of 494.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(4-acetamidophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(4-acetamidophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71372463 |
| Molecular Formula | C19H23N6O8P |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(4-acetamidophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)Nc1ccc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H23N6O8P/c1-10(26)24-12-4-2-11(3-5-12)6-20-17-14-18(22-8-21-17)25(9-23-14)19-16(28)15(27)13(33-19)7-32-34(29,30)31/h2-5,8-9,13,15-16,19,27-28H,6-7H2,1H3,(H,24,26)(H,20,21,22)(H2,29,30,31)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | OYJQTKOUOTZSBB-NVQRDWNXSA-N |
| XLogP | 0.13 |
| TPSA | 201.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|