C19H24N5O7P — CID 54576689
[(2R,3S,4R,5R)-5-[6-[(2,3-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 54576689) has the molecular formula C19H24N5O7P and a molecular weight of 465.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(2,3-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(2,3-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54576689 |
| Molecular Formula | C19H24N5O7P |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(2,3-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1cccc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1C |
| InChI | InChI=1S/C19H24N5O7P/c1-10-4-3-5-12(11(10)2)6-20-17-14-18(22-8-21-17)24(9-23-14)19-16(26)15(25)13(31-19)7-30-32(27,28)29/h3-5,8-9,13,15-16,19,25-26H,6-7H2,1-2H3,(H,20,21,22)(H2,27,28,29)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | GDRXOGBFMUWTCY-NVQRDWNXSA-N |
| XLogP | 0.78 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|