C20H26N5O10P — CID 54579556
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 54579556) has the molecular formula C20H26N5O10P and a molecular weight of 527.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54579556 |
| Molecular Formula | C20H26N5O10P |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3,4,5-trimethoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N5O10P/c1-31-11-4-10(5-12(32-2)17(11)33-3)6-21-18-14-19(23-8-22-18)25(9-24-14)20-16(27)15(26)13(35-20)7-34-36(28,29)30/h4-5,8-9,13,15-16,20,26-27H,6-7H2,1-3H3,(H,21,22,23)(H2,28,29,30)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | WVURRFRECXBNPA-KHTYJDQRSA-N |
| XLogP | 0.19 |
| TPSA | 199.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|