C17H19ClN5O8P — CID 71253822
[(2R,3S,4R,5R)-5-[6-[(3-chloro-2-hydroxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71253822) has the molecular formula C17H19ClN5O8P and a molecular weight of 487.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(3-chloro-2-hydroxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(3-chloro-2-hydroxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71253822 |
| Molecular Formula | C17H19ClN5O8P |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(3-chloro-2-hydroxyphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4cccc(Cl)c4O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19ClN5O8P/c18-9-3-1-2-8(12(9)24)4-19-15-11-16(21-6-20-15)23(7-22-11)17-14(26)13(25)10(31-17)5-30-32(27,28)29/h1-3,6-7,10,13-14,17,24-26H,4-5H2,(H,19,20,21)(H2,27,28,29)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | BXWZGLSMLXWZCM-IWCJZZDYSA-N |
| XLogP | 0.53 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|