C23H32N5O7P — CID 71253881
[(2R,3S,4R,5R)-5-[6-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71253881) has the molecular formula C23H32N5O7P and a molecular weight of 521.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71253881 |
| Molecular Formula | C23H32N5O7P |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H32N5O7P/c1-12-6-14(23(3,4)5)7-13(2)15(12)8-24-20-17-21(26-10-25-20)28(11-27-17)22-19(30)18(29)16(35-22)9-34-36(31,32)33/h6-7,10-11,16,18-19,22,29-30H,8-9H2,1-5H3,(H,24,25,26)(H2,31,32,33)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | DKYKHUYSBBYACR-WGQQHEPDSA-N |
| XLogP | 2.08 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|