C18H22N5O9P — CID 71253731
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-hydroxy-5-methoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71253731) has the molecular formula C18H22N5O9P and a molecular weight of 483.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-hydroxy-5-methoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-hydroxy-5-methoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71253731 |
| Molecular Formula | C18H22N5O9P |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[(3-hydroxy-5-methoxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(O)cc(CNc2ncnc3c2ncn3[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C18H22N5O9P/c1-30-11-3-9(2-10(24)4-11)5-19-16-13-17(21-7-20-16)23(8-22-13)18-15(26)14(25)12(32-18)6-31-33(27,28)29/h2-4,7-8,12,14-15,18,24-26H,5-6H2,1H3,(H,19,20,21)(H2,27,28,29)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | UXBMFRPIWDHWCS-SCFUHWHPSA-N |
| XLogP | -0.12 |
| TPSA | 201.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|