C17H18ClFN5O7P — CID 54577330
[(2R,3S,4R,5R)-5-[6-[(3-chloro-4-fluorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 54577330) has the molecular formula C17H18ClFN5O7P and a molecular weight of 489.78 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[(3-chloro-4-fluorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[(3-chloro-4-fluorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54577330 |
| Molecular Formula | C17H18ClFN5O7P |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[(3-chloro-4-fluorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(F)c(Cl)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H18ClFN5O7P/c18-9-3-8(1-2-10(9)19)4-20-15-12-16(22-6-21-15)24(7-23-12)17-14(26)13(25)11(31-17)5-30-32(27,28)29/h1-3,6-7,11,13-14,17,25-26H,4-5H2,(H,20,21,22)(H2,27,28,29)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | GRAQCWMNQQWTHW-LSCFUAHRSA-N |
| XLogP | 0.96 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|