C19H23N6O9P — CID 54173228
[(2R,3S,4R,5R)-5-[6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 54173228) has the molecular formula C19H23N6O9P and a molecular weight of 510.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 54173228 |
| Molecular Formula | C19H23N6O9P |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N6O9P/c20-11(5-9-1-3-10(26)4-2-9)18(29)24-16-13-17(22-7-21-16)25(8-23-13)19-15(28)14(27)12(34-19)6-33-35(30,31)32/h1-4,7-8,11-12,14-15,19,26-28H,5-6,20H2,(H2,30,31,32)(H,21,22,24,29)/t11-,12+,14+,15+,19+/m0/s1 |
| InChIKey | OWMDGUHOZNBRAZ-QTOWJTHWSA-N |
| XLogP | -1.23 |
| TPSA | 235.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|