C13H19N5O12P2 — CID 57358465
(2R)-2-[[9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]amino]-3-phosphonopropanoic acid (PubChem CID 57358465) has the molecular formula C13H19N5O12P2 and a molecular weight of 499.27 g/mol. Its IUPAC name is (2R)-2-[[9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]amino]-3-phosphonopropanoic acid.
| Compound Name | (2R)-2-[[9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]amino]-3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 57358465 |
| Molecular Formula | C13H19N5O12P2 |
| Molecular Weight | 499.27 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | (2R)-2-[[9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]purin-6-yl]amino]-3-phosphonopropanoic acid |
| SMILES | O=C(O)[C@H](CP(=O)(O)O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N5O12P2/c19-8-6(1-29-32(26,27)28)30-12(9(8)20)18-4-16-7-10(14-3-15-11(7)18)17-5(13(21)22)2-31(23,24)25/h3-6,8-9,12,19-20H,1-2H2,(H,21,22)(H,14,15,17)(H2,23,24,25)(H2,26,27,28)/t5-,6+,8-,9+,12+/m0/s1 |
| InChIKey | FGKAJDFZKDATMR-SOBUCJTESA-N |
| XLogP | -2.40 |
| TPSA | 266.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.27 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|