C12H18N5O6P — CID 169016791
[(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 169016791) has the molecular formula C12H18N5O6P and a molecular weight of 359.28 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 169016791 |
| Molecular Formula | C12H18N5O6P |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(C)(=O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H18N5O6P/c1-13-10-7-11(15-4-14-10)17(5-16-7)12-9(19)8(18)6(23-12)3-22-24(2,20)21/h4-6,8-9,12,18-19H,3H2,1-2H3,(H,20,21)(H,13,14,15)/t6-,8?,9+,12-/m1/s1 |
| InChIKey | ATBVNJFUNMIPRS-WURNFRPNSA-N |
| XLogP | -0.68 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|