C17H24N6O7P- — CID 59812499
[(2R,4S,5R)-5-[6-(cyclopentylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinate (PubChem CID 59812499) has the molecular formula C17H24N6O7P- and a molecular weight of 455.39 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[6-(cyclopentylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinate.
| Compound Name | [(2R,4S,5R)-5-[6-(cyclopentylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinate |
|---|---|
| PubChem CID | 59812499 |
| Molecular Formula | C17H24N6O7P- |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | [(2R,4S,5R)-5-[6-(cyclopentylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinate |
| SMILES | CP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(NC(=O)NC4CCCC4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C17H25N6O7P/c1-31(27,28)29-6-10-12(24)13(25)16(30-10)23-8-20-11-14(18-7-19-15(11)23)22-17(26)21-9-4-2-3-5-9/h7-10,12-13,16,24-25H,2-6H2,1H3,(H,27,28)(H2,18,19,21,22,26)/p-1/t10-,12?,13+,16-/m1/s1 |
| InChIKey | AVFNKCODGLPQLU-ZIWBQIBKSA-M |
| XLogP | -0.29 |
| TPSA | 183.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|