C14H17N5O6 — CID 23278063
[(2R,3S,4R,5R)-5-(6-acetamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 23278063) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-acetamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-acetamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23278063 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-acetamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17N5O6/c1-6(20)18-12-9-13(16-4-15-12)19(5-17-9)14-11(23)10(22)8(25-14)3-24-7(2)21/h4-5,8,10-11,14,22-23H,3H2,1-2H3,(H,15,16,18,20)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | FQFLMYFFOPDEHF-IDTAVKCVSA-N |
| XLogP | -1.03 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |