C20H29N7O12P2-2 — CID 59812538
(2-carboxypiperidin-4-yl)methyl-[[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxyphosphinate (PubChem CID 59812538) has the molecular formula C20H29N7O12P2-2 and a molecular weight of 621.44 g/mol. Its IUPAC name is (2-carboxypiperidin-4-yl)methyl-[[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxyphosphinate.
| Compound Name | (2-carboxypiperidin-4-yl)methyl-[[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxyphosphinate |
|---|---|
| PubChem CID | 59812538 |
| Molecular Formula | C20H29N7O12P2-2 |
| Molecular Weight | 621.44 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | (2-carboxypiperidin-4-yl)methyl-[[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxyphosphinate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])CC2CCNC(C(=O)O)C2)C(O)[C@@H]1O |
| InChI | InChI=1S/C20H31N7O12P2/c1-2-21-20(32)26-16-13-17(24-8-23-16)27(9-25-13)18-15(29)14(28)12(38-18)6-37-41(35,36)39-40(33,34)7-10-3-4-22-11(5-10)19(30)31/h8-12,14-15,18,22,28-29H,2-7H2,1H3,(H,30,31)(H,33,34)(H,35,36)(H2,21,23,24,26,32)/p-2/t10?,11?,12-,14?,15+,18-/m1/s1 |
| InChIKey | ANIBRKADORWXJG-XTSKKHIESA-L |
| XLogP | -1.91 |
| TPSA | 282.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.44 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|