C24H29N7O9P- — CID 59812458
[(3aS,4R,6R)-2-benzyl-4-[6-(ethylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-amino-2-carboxyethyl)phosphinate (PubChem CID 59812458) has the molecular formula C24H29N7O9P- and a molecular weight of 590.51 g/mol. Its IUPAC name is [(3aS,4R,6R)-2-benzyl-4-[6-(ethylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-amino-2-carboxyethyl)phosphinate.
| Compound Name | [(3aS,4R,6R)-2-benzyl-4-[6-(ethylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-amino-2-carboxyethyl)phosphinate |
|---|---|
| PubChem CID | 59812458 |
| Molecular Formula | C24H29N7O9P- |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | [(3aS,4R,6R)-2-benzyl-4-[6-(ethylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-amino-2-carboxyethyl)phosphinate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])CC(N)C(=O)O)C2OC(Cc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C24H30N7O9P/c1-2-26-24(34)30-20-17-21(28-11-27-20)31(12-29-17)22-19-18(39-16(40-19)8-13-6-4-3-5-7-13)15(38-22)9-37-41(35,36)10-14(25)23(32)33/h3-7,11-12,14-16,18-19,22H,2,8-10,25H2,1H3,(H,32,33)(H,35,36)(H2,26,27,28,30,34)/p-1/t14?,15-,16?,18?,19+,22-/m1/s1 |
| InChIKey | FCUYXNLYXQSMME-MGLJVUQPSA-M |
| XLogP | 0.20 |
| TPSA | 225.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|