C22H22N6O8P- — CID 58735001
[(4R,6R,6aS)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate (PubChem CID 58735001) has the molecular formula C22H22N6O8P- and a molecular weight of 529.43 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate.
| Compound Name | [(4R,6R,6aS)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 58735001 |
| Molecular Formula | C22H22N6O8P- |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | [(4R,6R,6aS)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])O)[C@@H]2OC(C#Cc3ccccc3)OC21 |
| InChI | InChI=1S/C22H23N6O8P/c1-2-23-22(29)27-19-16-20(25-11-24-19)28(12-26-16)21-18-17(14(34-21)10-33-37(30,31)32)35-15(36-18)9-8-13-6-4-3-5-7-13/h3-7,11-12,14-15,17-18,21H,2,10H2,1H3,(H2,30,31,32)(H2,23,24,25,27,29)/p-1/t14-,15?,17+,18?,21-/m1/s1 |
| InChIKey | JTKRYNBWKNGOGU-XHYALKRFSA-M |
| XLogP | 0.50 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|