C24H27N6O8P — CID 59834225
[(3aS,4R,6R)-4-[6-(butylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 59834225) has the molecular formula C24H27N6O8P and a molecular weight of 558.49 g/mol. Its IUPAC name is [(3aS,4R,6R)-4-[6-(butylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(3aS,4R,6R)-4-[6-(butylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59834225 |
| Molecular Formula | C24H27N6O8P |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [(3aS,4R,6R)-4-[6-(butylcarbamoylamino)purin-9-yl]-2-(2-phenylethynyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CCCCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)C2OC(C#Cc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C24H27N6O8P/c1-2-3-11-25-24(31)29-21-18-22(27-13-26-21)30(14-28-18)23-20-19(16(36-23)12-35-39(32,33)34)37-17(38-20)10-9-15-7-5-4-6-8-15/h4-8,13-14,16-17,19-20,23H,2-3,11-12H2,1H3,(H2,32,33,34)(H2,25,26,27,29,31)/t16-,17?,19?,20+,23-/m1/s1 |
| InChIKey | GMZUXAXMZMVJHK-KYLKUYHVSA-N |
| XLogP | 1.92 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|