C24H27N6O9P — CID 91499432
2-[[(2S,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]acetic acid (PubChem CID 91499432) has the molecular formula C24H27N6O9P and a molecular weight of 574.49 g/mol. Its IUPAC name is 2-[[(2S,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]acetic acid.
| Compound Name | 2-[[(2S,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]acetic acid |
|---|---|
| PubChem CID | 91499432 |
| Molecular Formula | C24H27N6O9P |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 2-[[(2S,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl]acetic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)CC(=O)O)C2O[C@H](C=Cc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C24H27N6O9P/c1-2-25-24(33)29-21-18-22(27-12-26-21)30(13-28-18)23-20-19(15(37-23)10-36-40(34,35)11-16(31)32)38-17(39-20)9-8-14-6-4-3-5-7-14/h3-9,12-13,15,17,19-20,23H,2,10-11H2,1H3,(H,31,32)(H,34,35)(H2,25,26,27,29,33)/t15-,17+,19?,20+,23-/m1/s1 |
| InChIKey | TYXLIHJCJPBUKS-GURBSPFZSA-N |
| XLogP | 1.98 |
| TPSA | 196.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|